C11H10F3NO — CID 134605046
4,6-dimethyl-2-(2,2,2-trifluoroethyl)furo[2,3-b]pyridine (PubChem CID 134605046) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 4,6-dimethyl-2-(2,2,2-trifluoroethyl)furo[2,3-b]pyridine.
| Compound Name | 4,6-dimethyl-2-(2,2,2-trifluoroethyl)furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 134605046 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4,6-dimethyl-2-(2,2,2-trifluoroethyl)furo[2,3-b]pyridine |
| SMILES | Cc1cc(C)c2cc(CC(F)(F)F)oc2n1 |
| InChI | InChI=1S/C11H10F3NO/c1-6-3-7(2)15-10-9(6)4-8(16-10)5-11(12,13)14/h3-4H,5H2,1-2H3 |
| InChIKey | KTTMXGAHMORODD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |