C25H24F4N4O4 — CID 134605063
(2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-[3-(difluoromethyl)phenyl]-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide (PubChem CID 134605063) has the molecular formula C25H24F4N4O4 and a molecular weight of 520.48 g/mol. Its IUPAC name is (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-[3-(difluoromethyl)phenyl]-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide.
| Compound Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-[3-(difluoromethyl)phenyl]-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
|---|---|
| PubChem CID | 134605063 |
| Molecular Formula | C25H24F4N4O4 |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-[3-(difluoromethyl)phenyl]-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3cccc(C(F)F)c3)n3c2C[C@H]2C[C@H]23)CC(F)(F)C1 |
| InChI | InChI=1S/C25H24F4N4O4/c1-11-17(19(34)22(36)32-24(23(37)30-2)9-25(28,29)10-24)16-8-13-7-15(13)33(16)18(11)21(35)31-14-5-3-4-12(6-14)20(26)27/h3-6,13,15,20H,7-10H2,1-2H3,(H,30,37)(H,31,35)(H,32,36)/t13-,15-/m1/s1 |
| InChIKey | KEENNNXETDCDDU-UKRRQHHQSA-N |
| XLogP | 3.32 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|