About 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine
2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 134605487) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 134605487 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | COCC1CCC(C)N1C(C)CN(C)C |
| InChI | InChI=1S/C12H26N2O/c1-10-6-7-12(9-15-5)14(10)11(2)8-13(3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | OSYNXTRMABOCIB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine (CID 134605487) is 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine is COCC1CCC(C)N1C(C)CN(C)C.
What is the InChIKey of 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is OSYNXTRMABOCIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-10-6-7-12(9-15-5)14(10)11(2)8-13(3)4/h10-12H,6-9H2,1-5H3.
What are the key properties of 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine?
2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 214.35 g/mol, XLogP of 1.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methoxymethyl)-5-methylpyrrolidin-1-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 134605487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).