C12H18O3 — CID 134605677
1-[(4R,5R)-2-(cyclobut-2-en-1-ylmethyl)-2,5-dimethyl-1,3-dioxolan-4-yl]ethanone (PubChem CID 134605677) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-[(4R,5R)-2-(cyclobut-2-en-1-ylmethyl)-2,5-dimethyl-1,3-dioxolan-4-yl]ethanone.
| Compound Name | 1-[(4R,5R)-2-(cyclobut-2-en-1-ylmethyl)-2,5-dimethyl-1,3-dioxolan-4-yl]ethanone |
|---|---|
| PubChem CID | 134605677 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-[(4R,5R)-2-(cyclobut-2-en-1-ylmethyl)-2,5-dimethyl-1,3-dioxolan-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1OC(C)(CC2C=CC2)O[C@@H]1C |
| InChI | InChI=1S/C12H18O3/c1-8(13)11-9(2)14-12(3,15-11)7-10-5-4-6-10/h4-5,9-11H,6-7H2,1-3H3/t9-,10?,11+,12?/m1/s1 |
| InChIKey | BVAUBLJRLJTHRD-ZYGVAYEYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|