C21H31N — CID 134606604
3-[2-(cyclohexen-1-yl)propan-2-yl]-7-propan-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 134606604) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)propan-2-yl]-7-propan-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-[2-(cyclohexen-1-yl)propan-2-yl]-7-propan-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 134606604 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)propan-2-yl]-7-propan-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)c1ccc2c(c1)NCC(C(C)(C)C1=CCCCC1)C2 |
| InChI | InChI=1S/C21H31N/c1-15(2)16-10-11-17-12-19(14-22-20(17)13-16)21(3,4)18-8-6-5-7-9-18/h8,10-11,13,15,19,22H,5-7,9,12,14H2,1-4H3 |
| InChIKey | OMYKLQRSEIKFKQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|