About (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone
(3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone (PubChem CID 1346070) has the molecular formula C18H16BrN3O3S
and a molecular weight of 434.32 g/mol. Its IUPAC name is (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone |
| PubChem CID | 1346070 |
| Molecular Formula | C18H16BrN3O3S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H16BrN3O3S/c19-14-5-3-4-13(12-14)18(23)22-10-8-21(9-11-22)17-15-6-1-2-7-16(15)26(24,25)20-17/h1-7,12H,8-11H2 |
| InChIKey | BBXKHIQTYJOBCS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone?
The IUPAC name of (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone (CID 1346070) is (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone.
What is the SMILES notation for (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone?
The canonical SMILES for (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone is O=C(c1cccc(Br)c1)N1CCN(C2=NS(=O)(=O)c3ccccc32)CC1.
What is the InChIKey of (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone?
The InChIKey is BBXKHIQTYJOBCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3O3S/c19-14-5-3-4-13(12-14)18(23)22-10-8-21(9-11-22)17-15-6-1-2-7-16(15)26(24,25)20-17/h1-7,12H,8-11H2.
What are the key properties of (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone?
(3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone has a molecular weight of 434.32 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 1346070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).