About 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium
5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium (PubChem CID 134607207) has the molecular formula C9H17N6O2+
and a molecular weight of 241.28 g/mol. Its IUPAC name is 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium.
Molecular Properties
| Compound Name | 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium |
| PubChem CID | 134607207 |
| Molecular Formula | C9H17N6O2+ |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium |
| SMILES | CC(C)[n+]1ccccc1.O=[N+]([O-])C1NNNN1 |
| InChI | InChI=1S/C8H12N.CH5N5O2/c1-8(2)9-6-4-3-5-7-9;7-6(8)1-2-4-5-3-1/h3-8H,1-2H3;1-5H/q+1; |
| InChIKey | JWYPIDYRLBMVQT-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium?
The IUPAC name of 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium (CID 134607207) is 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium.
What is the SMILES notation for 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium?
The canonical SMILES for 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium is CC(C)[n+]1ccccc1.O=[N+]([O-])C1NNNN1.
What is the InChIKey of 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium?
The InChIKey is JWYPIDYRLBMVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.CH5N5O2/c1-8(2)9-6-4-3-5-7-9;7-6(8)1-2-4-5-3-1/h3-8H,1-2H3;1-5H/q+1;.
What are the key properties of 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium?
5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium has a molecular weight of 241.28 g/mol, XLogP of -0.78, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrotetrazolidine;1-propan-2-ylpyridin-1-ium is sourced from PubChem (CID 134607207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).