C14H19NO4S2 — CID 134607315
4-(oxan-4-ylmethyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonic acid (PubChem CID 134607315) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-(oxan-4-ylmethyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonic acid.
| Compound Name | 4-(oxan-4-ylmethyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonic acid |
|---|---|
| PubChem CID | 134607315 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-(oxan-4-ylmethyl)-2,3-dihydro-1,4-benzothiazine-6-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)N(CC1CCOCC1)CCS2 |
| InChI | InChI=1S/C14H19NO4S2/c16-21(17,18)12-1-2-14-13(9-12)15(5-8-20-14)10-11-3-6-19-7-4-11/h1-2,9,11H,3-8,10H2,(H,16,17,18) |
| InChIKey | GKWHXBNINXNYRO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|