C14H14F3N3O5S — CID 134608362
3-[3-(aminomethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 134608362) has the molecular formula C14H14F3N3O5S and a molecular weight of 393.34 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-(aminomethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134608362 |
| Molecular Formula | C14H14F3N3O5S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-[3-(aminomethyl)-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCc1scc2c1CN(C1CCC(=O)NC1=O)C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H13N3O3S.C2HF3O2/c13-3-9-6-4-15(12(18)7(6)5-19-9)8-1-2-10(16)14-11(8)17;3-2(4,5)1(6)7/h5,8H,1-4,13H2,(H,14,16,17);(H,6,7) |
| InChIKey | WOFOEANXKJSMCG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|