About 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one
3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one (PubChem CID 134608505) has the molecular formula C13H14F2N2O2S
and a molecular weight of 300.33 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one |
| PubChem CID | 134608505 |
| Molecular Formula | C13H14F2N2O2S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one |
| SMILES | O=C1NCCCC[C@@H]1N1Cc2c(csc2C(F)F)C1=O |
| InChI | InChI=1S/C13H14F2N2O2S/c14-11(15)10-7-5-17(13(19)8(7)6-20-10)9-3-1-2-4-16-12(9)18/h6,9,11H,1-5H2,(H,16,18)/t9-/m0/s1 |
| InChIKey | YSRMKRLKDZRRKN-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one?
The IUPAC name of 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one (CID 134608505) is 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one.
What is the SMILES notation for 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one?
The canonical SMILES for 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one is O=C1NCCCC[C@@H]1N1Cc2c(csc2C(F)F)C1=O.
What is the InChIKey of 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one?
The InChIKey is YSRMKRLKDZRRKN-VIFPVBQESA-N. The full InChI is InChI=1S/C13H14F2N2O2S/c14-11(15)10-7-5-17(13(19)8(7)6-20-10)9-3-1-2-4-16-12(9)18/h6,9,11H,1-5H2,(H,16,18)/t9-/m0/s1.
What are the key properties of 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one?
3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one has a molecular weight of 300.33 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-5-[(3S)-2-oxoazepan-3-yl]-4H-thieno[3,4-c]pyrrol-6-one is sourced from PubChem (CID 134608505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).