C24H39N5O7 — CID 134608615
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]hexanoic acid (PubChem CID 134608615) has the molecular formula C24H39N5O7 and a molecular weight of 509.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 134608615 |
| Molecular Formula | C24H39N5O7 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]propanoyl]amino]hexanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C24H39N5O7/c1-15(2)21(28-18(30)10-5-4-8-14-29-19(31)11-12-20(29)32)23(34)26-16(3)22(33)27-17(24(35)36)9-6-7-13-25/h11-12,15-17,21H,4-10,13-14,25H2,1-3H3,(H,26,34)(H,27,33)(H,28,30)(H,35,36)/t16-,17-,21-/m0/s1 |
| InChIKey | GXZGGAPPNMVSED-FIKGOQFSSA-N |
| XLogP | -0.18 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|