C16H21N5O8 — CID 134608657
4-amino-2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoylamino]propanoylamino]-4-oxobutanoic acid (PubChem CID 134608657) has the molecular formula C16H21N5O8 and a molecular weight of 411.37 g/mol. Its IUPAC name is 4-amino-2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoylamino]propanoylamino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoylamino]propanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134608657 |
| Molecular Formula | C16H21N5O8 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-amino-2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoylamino]propanoylamino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)CN1C(=O)C=CC1=O)C(=O)NC(C)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H21N5O8/c1-7(18-11(23)6-21-12(24)3-4-13(21)25)14(26)19-8(2)15(27)20-9(16(28)29)5-10(17)22/h3-4,7-9H,5-6H2,1-2H3,(H2,17,22)(H,18,23)(H,19,26)(H,20,27)(H,28,29) |
| InChIKey | BSMJFOIQKIMJOJ-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|