C21H23ClFN3O2S — CID 134608899
(3R)-3-amino-N-butyl-5-[(4-chlorophenyl)methyl]-8-fluoro-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide (PubChem CID 134608899) has the molecular formula C21H23ClFN3O2S and a molecular weight of 435.95 g/mol. Its IUPAC name is (3R)-3-amino-N-butyl-5-[(4-chlorophenyl)methyl]-8-fluoro-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide.
| Compound Name | (3R)-3-amino-N-butyl-5-[(4-chlorophenyl)methyl]-8-fluoro-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
|---|---|
| PubChem CID | 134608899 |
| Molecular Formula | C21H23ClFN3O2S |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3R)-3-amino-N-butyl-5-[(4-chlorophenyl)methyl]-8-fluoro-4-oxo-2,3-dihydro-1,5-benzothiazepine-7-carboxamide |
| SMILES | CCCCNC(=O)c1cc2c(cc1F)SC[C@H](N)C(=O)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClFN3O2S/c1-2-3-8-25-20(27)15-9-18-19(10-16(15)23)29-12-17(24)21(28)26(18)11-13-4-6-14(22)7-5-13/h4-7,9-10,17H,2-3,8,11-12,24H2,1H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | MVVASNLBZOYHMR-KRWDZBQOSA-N |
| XLogP | 3.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|