C19H23ClN4O2 — CID 134609539
[1-[4-(5-amino-2-methylphenyl)-6-chloro-2-pyridinyl]-4-methylpiperidin-4-yl]carbamic acid (PubChem CID 134609539) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is [1-[4-(5-amino-2-methylphenyl)-6-chloro-2-pyridinyl]-4-methylpiperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-(5-amino-2-methylphenyl)-6-chloro-2-pyridinyl]-4-methylpiperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 134609539 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [1-[4-(5-amino-2-methylphenyl)-6-chloro-2-pyridinyl]-4-methylpiperidin-4-yl]carbamic acid |
| SMILES | Cc1ccc(N)cc1-c1cc(Cl)nc(N2CCC(C)(NC(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-12-3-4-14(21)11-15(12)13-9-16(20)22-17(10-13)24-7-5-19(2,6-8-24)23-18(25)26/h3-4,9-11,23H,5-8,21H2,1-2H3,(H,25,26) |
| InChIKey | OBKGSDJWEVPMSW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|