C24H21ClF3N7O2 — CID 134609844
N-(4-aminobutyl)-3-chloro-5-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxamide (PubChem CID 134609844) has the molecular formula C24H21ClF3N7O2 and a molecular weight of 531.93 g/mol. Its IUPAC name is N-(4-aminobutyl)-3-chloro-5-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxamide.
| Compound Name | N-(4-aminobutyl)-3-chloro-5-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134609844 |
| Molecular Formula | C24H21ClF3N7O2 |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N-(4-aminobutyl)-3-chloro-5-[[1-isoquinolin-4-yl-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]pyridine-2-carboxamide |
| SMILES | NCCCCNC(=O)c1ncc(NC(=O)c2cnn(-c3cncc4ccccc34)c2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C24H21ClF3N7O2/c25-18-9-15(11-32-20(18)23(37)31-8-4-3-7-29)34-22(36)17-12-33-35(21(17)24(26,27)28)19-13-30-10-14-5-1-2-6-16(14)19/h1-2,5-6,9-13H,3-4,7-8,29H2,(H,31,37)(H,34,36) |
| InChIKey | BMIJHROHAWYCKH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|