About US10208019, Example 10A-62
US10208019, Example 10A-62 (PubChem CID 134611069) has the molecular formula C31H30FN9O3
and a molecular weight of 595.60 g/mol. Its IUPAC name is 2-[[4-[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]piperazin-1-yl]methyl]-3-[(3-ethyltriazol-4-yl)methyl]benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | US10208019, Example 10A-62 |
| PubChem CID | 134611069 |
| Molecular Formula | C31H30FN9O3 |
| Molecular Weight | 595.60 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | 2-[[4-[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]piperazin-1-yl]methyl]-3-[(3-ethyltriazol-4-yl)methyl]benzimidazole-5-carboxylic acid |
| SMILES | CCN1C(=CN=N1)CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCN(CC4)C5=NC(=CC=C5)OCC6=C(C=C(C=C6)C#N)F |
| InChI | InChI=1S/C31H30FN9O3/c1-2-41-24(17-34-37-41)18-40-27-15-22(31(42)43)8-9-26(27)35-29(40)19-38-10-12-39(13-11-38)28-4-3-5-30(36-28)44-20-23-7-6-21(16-33)14-25(23)32/h3-9,14-15,17H,2,10-13,18-20H2,1H3,(H,42,43) |
| InChIKey | MEILDZONVGDFNF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | 1010 |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.60 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze US10208019, Example 10A-62 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10208019, Example 10A-62?
The IUPAC name of US10208019, Example 10A-62 (CID 134611069) is 2-[[4-[6-[(4-cyano-2-fluorophenyl)methoxy]-2-pyridinyl]piperazin-1-yl]methyl]-3-[(3-ethyltriazol-4-yl)methyl]benzimidazole-5-carboxylic acid.
What is the SMILES notation for US10208019, Example 10A-62?
The canonical SMILES for US10208019, Example 10A-62 is CCN1C(=CN=N1)CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCN(CC4)C5=NC(=CC=C5)OCC6=C(C=C(C=C6)C#N)F.
What is the InChIKey of US10208019, Example 10A-62?
The InChIKey is MEILDZONVGDFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30FN9O3/c1-2-41-24(17-34-37-41)18-40-27-15-22(31(42)43)8-9-26(27)35-29(40)19-38-10-12-39(13-11-38)28-4-3-5-30(36-28)44-20-23-7-6-21(16-33)14-25(23)32/h3-9,14-15,17H,2,10-13,18-20H2,1H3,(H,42,43).
What are the key properties of US10208019, Example 10A-62?
US10208019, Example 10A-62 has a molecular weight of 595.60 g/mol, XLogP of 0.70, 10 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for US10208019, Example 10A-62 is sourced from PubChem (CID 134611069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).