C17H14F5N5O3 — CID 134611411
(1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methyl-1-[[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]propan-2-ol (PubChem CID 134611411) has the molecular formula C17H14F5N5O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is (1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methyl-1-[[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]propan-2-ol.
| Compound Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methyl-1-[[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 134611411 |
| Molecular Formula | C17H14F5N5O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (1S)-1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methyl-1-[[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]propan-2-ol |
| SMILES | CC(C)(O)[C@@H](Nc1cc(C(F)(F)F)nc2ncnn12)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C17H14F5N5O3/c1-15(2,28)13(8-3-4-9-10(5-8)30-17(21,22)29-9)26-12-6-11(16(18,19)20)25-14-23-7-24-27(12)14/h3-7,13,26,28H,1-2H3/t13-/m0/s1 |
| InChIKey | NMJZNLIJWMPCSH-ZDUSSCGKSA-N |
| XLogP | 3.39 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |