C21H23N7O — CID 134611545
N-(2-cyanoethyl)-2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide (PubChem CID 134611545) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide |
|---|---|
| PubChem CID | 134611545 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-(2-cyanoethyl)-2-[3-[4-(cyanomethyl)cyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]acetamide |
| SMILES | N#CCCNC(=O)Cc1nc2cnc3[nH]ccc3c2n1C1CCC(CC#N)CC1 |
| InChI | InChI=1S/C21H23N7O/c22-8-1-10-24-19(29)12-18-27-17-13-26-21-16(7-11-25-21)20(17)28(18)15-4-2-14(3-5-15)6-9-23/h7,11,13-15H,1-6,10,12H2,(H,24,29)(H,25,26) |
| InChIKey | DZYJQAKCPQYEKD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|