About N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide
N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide (PubChem CID 134611695) has the molecular formula C19H15N3O2S
and a molecular weight of 349.42 g/mol. Its IUPAC name is N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide.
Molecular Properties
| Compound Name | N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide |
| PubChem CID | 134611695 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide |
| SMILES | O=C(NO)c1ccc(CN2c3ccccc3Sc3cccnc32)cc1 |
| InChI | InChI=1S/C19H15N3O2S/c23-19(21-24)14-9-7-13(8-10-14)12-22-15-4-1-2-5-16(15)25-17-6-3-11-20-18(17)22/h1-11,24H,12H2,(H,21,23) |
| InChIKey | PBCHBJALYWYEAP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide?
The IUPAC name of N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide (CID 134611695) is N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide.
What is the SMILES notation for N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide?
The canonical SMILES for N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide is O=C(NO)c1ccc(CN2c3ccccc3Sc3cccnc32)cc1.
What is the InChIKey of N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide?
The InChIKey is PBCHBJALYWYEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2S/c23-19(21-24)14-9-7-13(8-10-14)12-22-15-4-1-2-5-16(15)25-17-6-3-11-20-18(17)22/h1-11,24H,12H2,(H,21,23).
What are the key properties of N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide?
N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide has a molecular weight of 349.42 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-(pyrido[3,2-b][1,4]benzothiazin-10-ylmethyl)benzamide is sourced from PubChem (CID 134611695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).