About 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid
5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid (PubChem CID 134611747) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid |
| PubChem CID | 134611747 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CC[C@H](O)CO)cn1 |
| InChI | InChI=1S/C10H13NO4/c12-6-8(13)3-1-7-2-4-9(10(14)15)11-5-7/h2,4-5,8,12-13H,1,3,6H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | UVVYRQPKVBATGU-QMMMGPOBSA-N |
| XLogP | 0.07 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid (CID 134611747) is 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid is O=C(O)c1ccc(CC[C@H](O)CO)cn1.
What is the InChIKey of 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid?
The InChIKey is UVVYRQPKVBATGU-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H13NO4/c12-6-8(13)3-1-7-2-4-9(10(14)15)11-5-7/h2,4-5,8,12-13H,1,3,6H2,(H,14,15)/t8-/m0/s1.
What are the key properties of 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid?
5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-3,4-dihydroxybutyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 134611747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).