C9H8ClNO2 — CID 134611905
6-chloro-4-hydroxy-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 134611905) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-chloro-4-hydroxy-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-chloro-4-hydroxy-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 134611905 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-chloro-4-hydroxy-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCC(O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H8ClNO2/c10-5-1-2-6-7(3-5)8(12)4-11-9(6)13/h1-3,8,12H,4H2,(H,11,13) |
| InChIKey | HGWYNSFZVZDJBP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |