About 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine
3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine (PubChem CID 134611934) has the molecular formula C18H11F4N5
and a molecular weight of 373.31 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine |
| PubChem CID | 134611934 |
| Molecular Formula | C18H11F4N5 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine |
| SMILES | Fc1ccc(C(F)(F)F)cc1-c1nn(Cc2cnccn2)c2ccncc12 |
| InChI | InChI=1S/C18H11F4N5/c19-15-2-1-11(18(20,21)22)7-13(15)17-14-9-23-4-3-16(14)27(26-17)10-12-8-24-5-6-25-12/h1-9H,10H2 |
| InChIKey | MTUDPYFDBYHEOD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine?
The IUPAC name of 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine (CID 134611934) is 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine is Fc1ccc(C(F)(F)F)cc1-c1nn(Cc2cnccn2)c2ccncc12.
What is the InChIKey of 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine?
The InChIKey is MTUDPYFDBYHEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F4N5/c19-15-2-1-11(18(20,21)22)7-13(15)17-14-9-23-4-3-16(14)27(26-17)10-12-8-24-5-6-25-12/h1-9H,10H2.
What are the key properties of 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine?
3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine has a molecular weight of 373.31 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-(pyrazin-2-ylmethyl)pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 134611934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).