C23H27F3N8OS — CID 134612190
5-(1,3-benzothiazol-2-yl)-6-[[(3R)-piperidin-3-yl]amino]-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-1,3-diazinan-4-one (PubChem CID 134612190) has the molecular formula C23H27F3N8OS and a molecular weight of 520.59 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-6-[[(3R)-piperidin-3-yl]amino]-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-1,3-diazinan-4-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-6-[[(3R)-piperidin-3-yl]amino]-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 134612190 |
| Molecular Formula | C23H27F3N8OS |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-6-[[(3R)-piperidin-3-yl]amino]-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-1,3-diazinan-4-one |
| SMILES | O=C1NC(N2CCn3cc(C(F)(F)F)nc3C2)NC(N[C@@H]2CCCNC2)C1c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H27F3N8OS/c24-23(25,26)16-11-33-8-9-34(12-17(33)30-16)22-31-19(28-13-4-3-7-27-10-13)18(20(35)32-22)21-29-14-5-1-2-6-15(14)36-21/h1-2,5-6,11,13,18-19,22,27-28,31H,3-4,7-10,12H2,(H,32,35)/t13-,18?,19?,22?/m1/s1 |
| InChIKey | ZUJYHOUNOWVCSF-FMKAKYBOSA-N |
| XLogP | 1.78 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |