C18H20N2O — CID 134612416
4-(3,7-dimethylocta-2,6-dienoxy)benzene-1,2-dicarbonitrile (PubChem CID 134612416) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 134612416 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C18H20N2O/c1-14(2)5-4-6-15(3)9-10-21-18-8-7-16(12-19)17(11-18)13-20/h5,7-9,11H,4,6,10H2,1-3H3 |
| InChIKey | XTKYHXWBMWYWAL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|