C10H7F9O3 — CID 134612566
2-methoxy-2-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)furan-3-one (PubChem CID 134612566) has the molecular formula C10H7F9O3 and a molecular weight of 346.15 g/mol. Its IUPAC name is 2-methoxy-2-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)furan-3-one.
| Compound Name | 2-methoxy-2-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)furan-3-one |
|---|---|
| PubChem CID | 134612566 |
| Molecular Formula | C10H7F9O3 |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-methoxy-2-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)furan-3-one |
| SMILES | COC1(C)OC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=CC1=O |
| InChI | InChI=1S/C10H7F9O3/c1-6(21-2)4(20)3-5(22-6)7(11,12)8(13,14)9(15,16)10(17,18)19/h3H,1-2H3 |
| InChIKey | AIBPYIYYOSOJOF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|