C23H19ClO4 — CID 134612596
(2Z)-2-[(4-chlorophenyl)methylidene]spiro[6H-furo[3,2-g]chromene-7,1'-cyclohexane]-3,5-dione (PubChem CID 134612596) has the molecular formula C23H19ClO4 and a molecular weight of 394.85 g/mol. Its IUPAC name is (2Z)-2-[(4-chlorophenyl)methylidene]spiro[6H-furo[3,2-g]chromene-7,1'-cyclohexane]-3,5-dione.
| Compound Name | (2Z)-2-[(4-chlorophenyl)methylidene]spiro[6H-furo[3,2-g]chromene-7,1'-cyclohexane]-3,5-dione |
|---|---|
| PubChem CID | 134612596 |
| Molecular Formula | C23H19ClO4 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2Z)-2-[(4-chlorophenyl)methylidene]spiro[6H-furo[3,2-g]chromene-7,1'-cyclohexane]-3,5-dione |
| SMILES | O=C1CC2(CCCCC2)Oc2cc3c(cc21)C(=O)/C(=C/c1ccc(Cl)cc1)O3 |
| InChI | InChI=1S/C23H19ClO4/c24-15-6-4-14(5-7-15)10-21-22(26)17-11-16-18(25)13-23(8-2-1-3-9-23)28-20(16)12-19(17)27-21/h4-7,10-12H,1-3,8-9,13H2/b21-10- |
| InChIKey | ZWGUSFGUWYPKRA-FBHDLOMBSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|