About 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole
5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole (PubChem CID 134612665) has the molecular formula C7H9F3N2O
and a molecular weight of 194.16 g/mol. Its IUPAC name is 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole |
| PubChem CID | 134612665 |
| Molecular Formula | C7H9F3N2O |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole |
| SMILES | CCOC(c1ccn[nH]1)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O/c1-2-13-6(7(8,9)10)5-3-4-11-12-5/h3-4,6H,2H2,1H3,(H,11,12) |
| InChIKey | ALRWSYOIULHPSP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole?
The IUPAC name of 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole (CID 134612665) is 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole.
What is the SMILES notation for 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole?
The canonical SMILES for 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole is CCOC(c1ccn[nH]1)C(F)(F)F.
What is the InChIKey of 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole?
The InChIKey is ALRWSYOIULHPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O/c1-2-13-6(7(8,9)10)5-3-4-11-12-5/h3-4,6H,2H2,1H3,(H,11,12).
What are the key properties of 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole?
5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole has a molecular weight of 194.16 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethoxy-2,2,2-trifluoroethyl)-1H-pyrazole is sourced from PubChem (CID 134612665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).