About 3-buta-1,3-dienylpyrimidin-4-one
3-buta-1,3-dienylpyrimidin-4-one (PubChem CID 134612832) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-buta-1,3-dienylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-buta-1,3-dienylpyrimidin-4-one |
| PubChem CID | 134612832 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3-buta-1,3-dienylpyrimidin-4-one |
| SMILES | C=CC=Cn1cnccc1=O |
| InChI | InChI=1S/C8H8N2O/c1-2-3-6-10-7-9-5-4-8(10)11/h2-7H,1H2 |
| InChIKey | HPWFIHKQLHTBNX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-buta-1,3-dienylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-1,3-dienylpyrimidin-4-one?
The IUPAC name of 3-buta-1,3-dienylpyrimidin-4-one (CID 134612832) is 3-buta-1,3-dienylpyrimidin-4-one.
What is the SMILES notation for 3-buta-1,3-dienylpyrimidin-4-one?
The canonical SMILES for 3-buta-1,3-dienylpyrimidin-4-one is C=CC=Cn1cnccc1=O.
What is the InChIKey of 3-buta-1,3-dienylpyrimidin-4-one?
The InChIKey is HPWFIHKQLHTBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-2-3-6-10-7-9-5-4-8(10)11/h2-7H,1H2.
What are the key properties of 3-buta-1,3-dienylpyrimidin-4-one?
3-buta-1,3-dienylpyrimidin-4-one has a molecular weight of 148.16 g/mol, XLogP of 0.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-1,3-dienylpyrimidin-4-one is sourced from PubChem (CID 134612832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).