About 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione
5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione (PubChem CID 134612917) has the molecular formula C6H8BrN3O5
and a molecular weight of 282.05 g/mol. Its IUPAC name is 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione |
| PubChem CID | 134612917 |
| Molecular Formula | C6H8BrN3O5 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione |
| SMILES | COC1(C)NC(=O)NC(=O)C1(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C6H8BrN3O5/c1-5(15-2)6(7,10(13)14)3(11)8-4(12)9-5/h1-2H3,(H2,8,9,11,12) |
| InChIKey | AZDMLADNWQZOQN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione?
The IUPAC name of 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione (CID 134612917) is 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione.
What is the SMILES notation for 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione?
The canonical SMILES for 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione is COC1(C)NC(=O)NC(=O)C1(Br)[N+](=O)[O-].
What is the InChIKey of 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione?
The InChIKey is AZDMLADNWQZOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3O5/c1-5(15-2)6(7,10(13)14)3(11)8-4(12)9-5/h1-2H3,(H2,8,9,11,12).
What are the key properties of 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione?
5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione has a molecular weight of 282.05 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione is sourced from PubChem (CID 134612917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).