C6H8BrN3O5 — CID 134612917
5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione (PubChem CID 134612917) has the molecular formula C6H8BrN3O5 and a molecular weight of 282.05 g/mol. Its IUPAC name is 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione.
| Compound Name | 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 134612917 |
| Molecular Formula | C6H8BrN3O5 |
| Molecular Weight | 282.05 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 5-bromo-6-methoxy-6-methyl-5-nitro-1,3-diazinane-2,4-dione |
| SMILES | COC1(C)NC(=O)NC(=O)C1(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C6H8BrN3O5/c1-5(15-2)6(7,10(13)14)3(11)8-4(12)9-5/h1-2H3,(H2,8,9,11,12) |
| InChIKey | AZDMLADNWQZOQN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.05 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|