C24H27F3O3 — CID 134612971
methyl 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 134612971) has the molecular formula C24H27F3O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134612971 |
| Molecular Formula | C24H27F3O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | methyl 2-[(5R,8S,8aR)-3,8-dimethyl-2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C)[C@H]2C(=C(C)C(=O)C2Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H27F3O3/c1-13-8-9-17(14(2)23(29)30-4)12-19-15(3)22(28)20(21(13)19)11-16-6-5-7-18(10-16)24(25,26)27/h5-7,10,13,17,20-21H,2,8-9,11-12H2,1,3-4H3/t13-,17+,20?,21-/m0/s1 |
| InChIKey | MFNZZNGMKJLTPU-ODALGNTRSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|