C23H26F2O3 — CID 134613004
methyl 2-[(5R,8S,8aR)-1-[(2,4-difluorophenyl)methyl]-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 134613004) has the molecular formula C23H26F2O3 and a molecular weight of 388.45 g/mol. Its IUPAC name is methyl 2-[(5R,8S,8aR)-1-[(2,4-difluorophenyl)methyl]-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(5R,8S,8aR)-1-[(2,4-difluorophenyl)methyl]-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134613004 |
| Molecular Formula | C23H26F2O3 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methyl 2-[(5R,8S,8aR)-1-[(2,4-difluorophenyl)methyl]-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C)[C@H]2C(=C(C)C(=O)C2Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H26F2O3/c1-12-5-6-15(13(2)23(27)28-4)9-18-14(3)22(26)19(21(12)18)10-16-7-8-17(24)11-20(16)25/h7-8,11-12,15,19,21H,2,5-6,9-10H2,1,3-4H3/t12-,15+,19?,21-/m0/s1 |
| InChIKey | WXZTYJWHNQYCGD-YTGGVUPUSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|