C7H10N2O3S — CID 134613200
4-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1,3-dihydroimidazole-2-thione (PubChem CID 134613200) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 4-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 134613200 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 4-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-1,3-dihydroimidazole-2-thione |
| SMILES | O[C@@H]1[C@@H](O)CO[C@H]1c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C7H10N2O3S/c10-4-2-12-6(5(4)11)3-1-8-7(13)9-3/h1,4-6,10-11H,2H2,(H2,8,9,13)/t4-,5+,6-/m0/s1 |
| InChIKey | SKOBBIDRDNBDHN-JKUQZMGJSA-N |
| XLogP | -0.13 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|