C9H8F3NO2S — CID 134615627
2,5-dimethyl-1-nitro-3-(trifluoromethylsulfanyl)benzene (PubChem CID 134615627) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is 2,5-dimethyl-1-nitro-3-(trifluoromethylsulfanyl)benzene.
| Compound Name | 2,5-dimethyl-1-nitro-3-(trifluoromethylsulfanyl)benzene |
|---|---|
| PubChem CID | 134615627 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2,5-dimethyl-1-nitro-3-(trifluoromethylsulfanyl)benzene |
| SMILES | Cc1cc(SC(F)(F)F)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8F3NO2S/c1-5-3-7(13(14)15)6(2)8(4-5)16-9(10,11)12/h3-4H,1-2H3 |
| InChIKey | ORUPKNBAQXVSHZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|