C11H8BrF5O2 — CID 134616694
1-bromo-3-[4-(difluoromethyl)-2-(trifluoromethoxy)phenyl]propan-2-one (PubChem CID 134616694) has the molecular formula C11H8BrF5O2 and a molecular weight of 347.08 g/mol. Its IUPAC name is 1-bromo-3-[4-(difluoromethyl)-2-(trifluoromethoxy)phenyl]propan-2-one.
| Compound Name | 1-bromo-3-[4-(difluoromethyl)-2-(trifluoromethoxy)phenyl]propan-2-one |
|---|---|
| PubChem CID | 134616694 |
| Molecular Formula | C11H8BrF5O2 |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 1-bromo-3-[4-(difluoromethyl)-2-(trifluoromethoxy)phenyl]propan-2-one |
| SMILES | O=C(CBr)Cc1ccc(C(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H8BrF5O2/c12-5-8(18)3-6-1-2-7(10(13)14)4-9(6)19-11(15,16)17/h1-2,4,10H,3,5H2 |
| InChIKey | HNQKOSMWUUSJKM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|