C13H6F6 — CID 134617400
1,2,3-trifluoro-4-[3-(trifluoromethyl)phenyl]benzene (PubChem CID 134617400) has the molecular formula C13H6F6 and a molecular weight of 276.18 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-[3-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-4-[3-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134617400 |
| Molecular Formula | C13H6F6 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1,2,3-trifluoro-4-[3-(trifluoromethyl)phenyl]benzene |
| SMILES | Fc1ccc(-c2cccc(C(F)(F)F)c2)c(F)c1F |
| InChI | InChI=1S/C13H6F6/c14-10-5-4-9(11(15)12(10)16)7-2-1-3-8(6-7)13(17,18)19/h1-6H |
| InChIKey | QTOOGXRYDWTBFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|