C19H10ClF6N — CID 134617505
5-chloro-2,3-bis[3-(trifluoromethyl)phenyl]pyridine (PubChem CID 134617505) has the molecular formula C19H10ClF6N and a molecular weight of 401.74 g/mol. Its IUPAC name is 5-chloro-2,3-bis[3-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 5-chloro-2,3-bis[3-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134617505 |
| Molecular Formula | C19H10ClF6N |
| Molecular Weight | 401.74 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-chloro-2,3-bis[3-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1cccc(-c2cc(Cl)cnc2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H10ClF6N/c20-15-9-16(11-3-1-5-13(7-11)18(21,22)23)17(27-10-15)12-4-2-6-14(8-12)19(24,25)26/h1-10H |
| InChIKey | PXQWVRPLUXPNEW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |