C15H5Cl6NS — CID 134617770
2,4-bis(2,4,6-trichlorophenyl)-1,3-thiazole (PubChem CID 134617770) has the molecular formula C15H5Cl6NS and a molecular weight of 444.00 g/mol. Its IUPAC name is 2,4-bis(2,4,6-trichlorophenyl)-1,3-thiazole.
| Compound Name | 2,4-bis(2,4,6-trichlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 134617770 |
| Molecular Formula | C15H5Cl6NS |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 440.83 |
| IUPAC Name | 2,4-bis(2,4,6-trichlorophenyl)-1,3-thiazole |
| SMILES | Clc1cc(Cl)c(-c2csc(-c3c(Cl)cc(Cl)cc3Cl)n2)c(Cl)c1 |
| InChI | InChI=1S/C15H5Cl6NS/c16-6-1-8(18)13(9(19)2-6)12-5-23-15(22-12)14-10(20)3-7(17)4-11(14)21/h1-5H |
| InChIKey | KSXIFKBJVVPKIS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |