C12H5Cl5OS — CID 134618423
1-[5-(2,3,4,5,6-pentachlorophenyl)thiophen-2-yl]ethanone (PubChem CID 134618423) has the molecular formula C12H5Cl5OS and a molecular weight of 374.50 g/mol. Its IUPAC name is 1-[5-(2,3,4,5,6-pentachlorophenyl)thiophen-2-yl]ethanone.
| Compound Name | 1-[5-(2,3,4,5,6-pentachlorophenyl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 134618423 |
| Molecular Formula | C12H5Cl5OS |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 371.85 |
| IUPAC Name | 1-[5-(2,3,4,5,6-pentachlorophenyl)thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C12H5Cl5OS/c1-4(18)5-2-3-6(19-5)7-8(13)10(15)12(17)11(16)9(7)14/h2-3H,1H3 |
| InChIKey | KCWMSFLAGNSIJO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|