C13H8Cl3FO — CID 134620248
1,2,3-trichloro-5-(2-fluoro-3-methoxyphenyl)benzene (PubChem CID 134620248) has the molecular formula C13H8Cl3FO and a molecular weight of 305.56 g/mol. Its IUPAC name is 1,2,3-trichloro-5-(2-fluoro-3-methoxyphenyl)benzene.
| Compound Name | 1,2,3-trichloro-5-(2-fluoro-3-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 134620248 |
| Molecular Formula | C13H8Cl3FO |
| Molecular Weight | 305.56 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 1,2,3-trichloro-5-(2-fluoro-3-methoxyphenyl)benzene |
| SMILES | COc1cccc(-c2cc(Cl)c(Cl)c(Cl)c2)c1F |
| InChI | InChI=1S/C13H8Cl3FO/c1-18-11-4-2-3-8(13(11)17)7-5-9(14)12(16)10(15)6-7/h2-6H,1H3 |
| InChIKey | MNDRSMACEGDRIO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|