C13H8Cl5NO2 — CID 134620848
[2-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-3-pyridinyl]methanol (PubChem CID 134620848) has the molecular formula C13H8Cl5NO2 and a molecular weight of 387.48 g/mol. Its IUPAC name is [2-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-3-pyridinyl]methanol.
| Compound Name | [2-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 134620848 |
| Molecular Formula | C13H8Cl5NO2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 384.90 |
| IUPAC Name | [2-methoxy-5-(2,3,4,5,6-pentachlorophenyl)-3-pyridinyl]methanol |
| SMILES | COc1ncc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1CO |
| InChI | InChI=1S/C13H8Cl5NO2/c1-21-13-6(4-20)2-5(3-19-13)7-8(14)10(16)12(18)11(17)9(7)15/h2-3,20H,4H2,1H3 |
| InChIKey | CIDGJRGNYIHGNK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|