C13H9Cl2I — CID 134623247
1,2-dichloro-4-(4-iodo-2-methylphenyl)benzene (PubChem CID 134623247) has the molecular formula C13H9Cl2I and a molecular weight of 363.03 g/mol. Its IUPAC name is 1,2-dichloro-4-(4-iodo-2-methylphenyl)benzene.
| Compound Name | 1,2-dichloro-4-(4-iodo-2-methylphenyl)benzene |
|---|---|
| PubChem CID | 134623247 |
| Molecular Formula | C13H9Cl2I |
| Molecular Weight | 363.03 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | 1,2-dichloro-4-(4-iodo-2-methylphenyl)benzene |
| SMILES | Cc1cc(I)ccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl2I/c1-8-6-10(16)3-4-11(8)9-2-5-12(14)13(15)7-9/h2-7H,1H3 |
| InChIKey | ZEAWCZQGOCQUJH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.03 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|