C13H6Cl2FN — CID 134623799
2-(3,5-dichlorophenyl)-3-fluorobenzonitrile (PubChem CID 134623799) has the molecular formula C13H6Cl2FN and a molecular weight of 266.10 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-3-fluorobenzonitrile.
| Compound Name | 2-(3,5-dichlorophenyl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 134623799 |
| Molecular Formula | C13H6Cl2FN |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-3-fluorobenzonitrile |
| SMILES | N#Cc1cccc(F)c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H6Cl2FN/c14-10-4-9(5-11(15)6-10)13-8(7-17)2-1-3-12(13)16/h1-6H |
| InChIKey | OPZXSLUNVNZMGL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |