C11H12Cl4O4 — CID 13462419
methyl (1R,2R,4S)-1,4,5,6-tetrachloro-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 13462419) has the molecular formula C11H12Cl4O4 and a molecular weight of 350.03 g/mol. Its IUPAC name is methyl (1R,2R,4S)-1,4,5,6-tetrachloro-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2R,4S)-1,4,5,6-tetrachloro-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 13462419 |
| Molecular Formula | C11H12Cl4O4 |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | methyl (1R,2R,4S)-1,4,5,6-tetrachloro-7,7-dimethoxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)C2(OC)OC |
| InChI | InChI=1S/C11H12Cl4O4/c1-17-8(16)5-4-9(14)6(12)7(13)10(5,15)11(9,18-2)19-3/h5H,4H2,1-3H3/t5-,9-,10+/m1/s1 |
| InChIKey | LHVTVVKGOZZWQP-PDFZIDOMSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|