C13H17BrO3 — CID 134624450
3-bromo-1-(2,6-diethoxyphenyl)propan-1-one (PubChem CID 134624450) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 3-bromo-1-(2,6-diethoxyphenyl)propan-1-one.
| Compound Name | 3-bromo-1-(2,6-diethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 134624450 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-bromo-1-(2,6-diethoxyphenyl)propan-1-one |
| SMILES | CCOc1cccc(OCC)c1C(=O)CCBr |
| InChI | InChI=1S/C13H17BrO3/c1-3-16-11-6-5-7-12(17-4-2)13(11)10(15)8-9-14/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | WOZGMOABXLSHPU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|