C14H9Cl3F2O — CID 134626671
1,2,4-trichloro-5-[3-(difluoromethyl)-4-methoxyphenyl]benzene (PubChem CID 134626671) has the molecular formula C14H9Cl3F2O and a molecular weight of 337.58 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[3-(difluoromethyl)-4-methoxyphenyl]benzene.
| Compound Name | 1,2,4-trichloro-5-[3-(difluoromethyl)-4-methoxyphenyl]benzene |
|---|---|
| PubChem CID | 134626671 |
| Molecular Formula | C14H9Cl3F2O |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 1,2,4-trichloro-5-[3-(difluoromethyl)-4-methoxyphenyl]benzene |
| SMILES | COc1ccc(-c2cc(Cl)c(Cl)cc2Cl)cc1C(F)F |
| InChI | InChI=1S/C14H9Cl3F2O/c1-20-13-3-2-7(4-9(13)14(18)19)8-5-11(16)12(17)6-10(8)15/h2-6,14H,1H3 |
| InChIKey | OSYQPGSMFLQVMG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|