About 2-nitrosophenol
2-nitrosophenol (PubChem CID 13462789) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is 2-nitrosophenol.
Molecular Properties
| Compound Name | 2-nitrosophenol |
| PubChem CID | 13462789 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 2-nitrosophenol |
| SMILES | O=Nc1ccccc1O |
| InChI | InChI=1S/C6H5NO2/c8-6-4-2-1-3-5(6)7-9/h1-4,8H |
| InChIKey | SEEZWGFVHCMHJF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-nitrosophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosophenol?
The IUPAC name of 2-nitrosophenol (CID 13462789) is 2-nitrosophenol.
What is the SMILES notation for 2-nitrosophenol?
The canonical SMILES for 2-nitrosophenol is O=Nc1ccccc1O.
What is the InChIKey of 2-nitrosophenol?
The InChIKey is SEEZWGFVHCMHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2/c8-6-4-2-1-3-5(6)7-9/h1-4,8H.
What are the key properties of 2-nitrosophenol?
2-nitrosophenol has a molecular weight of 123.11 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosophenol is sourced from PubChem (CID 13462789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).