C20H10F6N2O2 — CID 134629098
5,6-bis[2-(trifluoromethoxy)phenyl]pyridine-3-carbonitrile (PubChem CID 134629098) has the molecular formula C20H10F6N2O2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 5,6-bis[2-(trifluoromethoxy)phenyl]pyridine-3-carbonitrile.
| Compound Name | 5,6-bis[2-(trifluoromethoxy)phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134629098 |
| Molecular Formula | C20H10F6N2O2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 5,6-bis[2-(trifluoromethoxy)phenyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(-c2ccccc2OC(F)(F)F)c(-c2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H10F6N2O2/c21-19(22,23)29-16-7-3-1-5-13(16)15-9-12(10-27)11-28-18(15)14-6-2-4-8-17(14)30-20(24,25)26/h1-9,11H |
| InChIKey | MRZVASBWXAZCJX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |