About 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine
2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine (PubChem CID 134630613) has the molecular formula C14H11Cl4N
and a molecular weight of 335.06 g/mol. Its IUPAC name is 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine |
| PubChem CID | 134630613 |
| Molecular Formula | C14H11Cl4N |
| Molecular Weight | 335.06 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine |
| SMILES | NCCc1cccc(Cl)c1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl4N/c15-9-6-11(17)14(12(18)7-9)13-8(4-5-19)2-1-3-10(13)16/h1-3,6-7H,4-5,19H2 |
| InChIKey | MXGXLUFHTUFXIW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine?
The IUPAC name of 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine (CID 134630613) is 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine.
What is the SMILES notation for 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine?
The canonical SMILES for 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine is NCCc1cccc(Cl)c1-c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine?
The InChIKey is MXGXLUFHTUFXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl4N/c15-9-6-11(17)14(12(18)7-9)13-8(4-5-19)2-1-3-10(13)16/h1-3,6-7H,4-5,19H2.
What are the key properties of 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine?
2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine has a molecular weight of 335.06 g/mol, XLogP of 5.47, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-2-(2,4,6-trichlorophenyl)phenyl]ethanamine is sourced from PubChem (CID 134630613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).