3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride

C14H7Cl2F3O — CID 134630863

IUPAC3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride
SMILESO=C(Cl)c1cccc(Cl)c1-c1ccccc1C(F)(F)F
InChIInChI=1S/C14H7Cl2F3O/c15-11-7-3-5-9(13(16)20)12(11)8-4-1-2-6-10(8)14(17,18)19/h1-7H
InChIKeyRGKCBKRACBUXGT-UHFFFAOYSA-N
MW319.11 g/mol
LogP5.40
Rot. Bonds2

About 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride

3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride (PubChem CID 134630863) has the molecular formula C14H7Cl2F3O and a molecular weight of 319.11 g/mol. Its IUPAC name is 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride.

Molecular Properties

Compound Name3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride
PubChem CID134630863
Molecular FormulaC14H7Cl2F3O
Molecular Weight319.11 g/mol
Exact Mass317.98
IUPAC Name3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride
SMILESO=C(Cl)c1cccc(Cl)c1-c1ccccc1C(F)(F)F
InChIInChI=1S/C14H7Cl2F3O/c15-11-7-3-5-9(13(16)20)12(11)8-4-1-2-6-10(8)14(17,18)19/h1-7H
InChIKeyRGKCBKRACBUXGT-UHFFFAOYSA-N
XLogP5.40
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500319.11
LogP ≤ 55.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride?
The IUPAC name of 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride (CID 134630863) is 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride.
What is the SMILES notation for 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride?
The canonical SMILES for 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride is O=C(Cl)c1cccc(Cl)c1-c1ccccc1C(F)(F)F.
What is the InChIKey of 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride?
The InChIKey is RGKCBKRACBUXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7Cl2F3O/c15-11-7-3-5-9(13(16)20)12(11)8-4-1-2-6-10(8)14(17,18)19/h1-7H.
What are the key properties of 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride?
3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride has a molecular weight of 319.11 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[2-(trifluoromethyl)phenyl]benzoyl chloride is sourced from PubChem (CID 134630863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).