C12H4Cl5FO — CID 134631237
4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenol (PubChem CID 134631237) has the molecular formula C12H4Cl5FO and a molecular weight of 360.43 g/mol. Its IUPAC name is 4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenol.
| Compound Name | 4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenol |
|---|---|
| PubChem CID | 134631237 |
| Molecular Formula | C12H4Cl5FO |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 357.87 |
| IUPAC Name | 4-fluoro-3-(2,3,4,5,6-pentachlorophenyl)phenol |
| SMILES | Oc1ccc(F)c(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H4Cl5FO/c13-8-7(5-3-4(19)1-2-6(5)18)9(14)11(16)12(17)10(8)15/h1-3,19H |
| InChIKey | DCPOPWDOGALLPB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|